Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Atorvastatin is an HMG-CoA reductase inhibitor (IC50 = 154 nM) that is effective in treating hypercholesterolemia and certain dyslipidemias. |
|---|
| Catalog Num | A13743 |
|---|---|
| Formula | C33H35FN2O5 |
| Molecular Weight | 558.6 |
| CAS Number | 134523-00-5 |
| SMILES | CC(C)C1=C(C(=C(N1CC[C@H](C[C@H](CC(=O)O)O)O)C2=CC=C(C=C2)F)C3=CC=CC=C3)C(=O)NC4=CC=CC=C4 |
| Synonyms | Cardyl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (161.1 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.9 mL | 89.51 mL | 179.02 mL |
| 0.5 mM | 3.58 mL | 17.9 mL | 35.8 mL |
| 1 mM | 1.79 mL | 8.95 mL | 17.9 mL |
| 5 mM | 0.36 mL | 1.79 mL | 3.58 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
