Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Aucubin is an iridoid glycoside. Irioids decrease the growth rates of many generalist herbivores. |
|---|
| Catalog Num | A12294 |
|---|---|
| Formula | C15H22O9 |
| Molecular Weight | 346.33 |
| CAS Number | 479-98-1 |
| SMILES | C1=CO[C@H]([C@H]2[C@@H]1[C@@H](C=C2CO)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (196.34 mM) | |
| Water | 15 mg/mL (43.31 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.87 mL | 144.37 mL | 288.74 mL |
| 0.5 mM | 5.77 mL | 28.87 mL | 57.75 mL |
| 1 mM | 2.89 mL | 14.44 mL | 28.87 mL |
| 5 mM | 0.58 mL | 2.89 mL | 5.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
