Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Azacyclonol, also known as γ-pipradol, is a drug used to diminish hallucinations in psychotic individuals. |
|---|
| Catalog Num | A11806 |
|---|---|
| Formula | C18H21NO |
| Molecular Weight | 267.37 |
| CAS Number | 115-46-8 |
| SMILES | C1CNCCC1C(C2=CC=CC=C2)(C3=CC=CC=C3)O |
| Synonyms | gamma-Pipradol |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 49 mg/mL (183.26 mM) | |
| Water | 2 mg/mL (7.48 mM) | ||
| Ethanol | 49 mg/mL (183.26 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.4 mL | 187.01 mL | 374.01 mL |
| 0.5 mM | 7.48 mL | 37.4 mL | 74.8 mL |
| 1 mM | 3.74 mL | 18.7 mL | 37.4 mL |
| 5 mM | 0.75 mL | 3.74 mL | 7.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
