AZD 9272
Catalog No.: A19738
mGluR5 antagonist
AZD 9272 is a brain penetrant mGluR5 antagonist.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | AZD 9272 is a brain penetrant mGluR5 antagonist. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A19738 |
|---|---|
| Formula | C14H6F2N4O |
| Molecular Weight | 284.22 |
| CAS Number | 327056-26-8 |
| SMILES | N#CC1=CC(F)=CC(C2=NC(C3=CC=C(F)C=N3)=NO2)=C1 |
| Synonyms | AZD9272, AZD-9272 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2