Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AZD-9291 is a third-generation EGFR inhibitor, showed promise in preclinical studies and provides hope for patients with advanced lung cancers that have become resistant to existing EGFR inhibitors. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13681 |
|---|---|
| Formula | C28H33N7O2 |
| Molecular Weight | 499.61 |
| CAS Number | 1421373-65-0 |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=NC(=NC=C3)NC4=C(C=C(C(=C4)NC(=O)C=C)N(C)CCN(C)C)OC |
| Synonyms | AZD 9291, AZD9291 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 90 mg/mL (180.14 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 39 mg/mL (78.05 mM) | ||
| In vivo | 5%DMSO+40%PEG300+5%Tween80+50%ddH2O | 7.1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.02 mL | 100.08 mL | 200.16 mL |
| 0.5 mM | 4 mL | 20.02 mL | 40.03 mL |
| 1 mM | 2 mL | 10.01 mL | 20.02 mL |
| 5 mM | 0.4 mL | 2 mL | 4 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
