Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | AZD5438 is a potent inhibitor of cyclin-dependent kinase (CDK) 1, 2 and 9 (IC50 values are 16, 6 and 20 nM respectively). | |||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A11105 |
|---|---|
| Formula | C18H21N5O2S |
| Molecular Weight | 371.5 |
| CAS Number | 602306-29-6 |
| SMILES | CC1=NC=C(N1C(C)C)C2=NC(=NC=C2)NC3=CC=C(C=C3)S(=O)(=O)C |
| Synonyms | AZD-5438 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (183.06 mM) | |
| Water | Insoluble | ||
| Ethanol | 68 mg/mL (183.06 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.92 mL | 134.59 mL | 269.18 mL |
| 0.5 mM | 5.38 mL | 26.92 mL | 53.84 mL |
| 1 mM | 2.69 mL | 13.46 mL | 26.92 mL |
| 5 mM | 0.54 mL | 2.69 mL | 5.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
