Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | AZD7762 is a potent ATP-competitive checkpoint kinase inhibitor that drives checkpoint abrogation and potentiates DNA-targeted therapies. | |||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A10113 |
|---|---|
| Formula | C17H19FN4O2S |
| Molecular Weight | 362.4 |
| CAS Number | 860352-01-8 |
| SMILES | C1C[C@@H](CNC1)NC(=O)C2=C(C=C(S2)C3=CC(=CC=C3)F)NC(=O)N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (137.96 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.59 mL | 137.97 mL | 275.94 mL |
| 0.5 mM | 5.52 mL | 27.59 mL | 55.19 mL |
| 1 mM | 2.76 mL | 13.8 mL | 27.59 mL |
| 5 mM | 0.55 mL | 2.76 mL | 5.52 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
