Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AZD8055 is a potent, selective, and orally bioavailable ATP-competitive mTOR kinase inhibitor with an IC50 of 0.8 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10114 |
|---|---|
| Formula | C25H31N5O4 |
| Molecular Weight | 465.5 |
| CAS Number | 1009298-09-2 |
| SMILES | C[C@H]1COCCN1C2=NC(=NC3=C2C=CC(=N3)C4=CC(=C(C=C4)OC)CO)N5CCOC[C@@H]5C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 49 mg/mL (105.25 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (6.44 mM) | ||
| In vivo | 4% DMSO+30% PEG 300+ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.48 mL | 107.41 mL | 214.82 mL |
| 0.5 mM | 4.3 mL | 21.48 mL | 42.96 mL |
| 1 mM | 2.15 mL | 10.74 mL | 21.48 mL |
| 5 mM | 0.43 mL | 2.15 mL | 4.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
