Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Bafetinib ((INNO-406) is a dual Bcr-Abl/Lyn tyrosine kinase inhibitor for the potential treatment of leukemia. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10119 |
|---|---|
| Formula | C30H31F3N8O |
| Molecular Weight | 576.6 |
| CAS Number | 859212-16-1 |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=C(C=C2)CN3CC[C@@H](C3)N(C)C)C(F)(F)F)NC4=NC=CC(=N4)C5=CN=CN=C5 |
| Synonyms | NS-187 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 92 mg/mL (159.55 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% methylcellulose+0.2% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.34 mL | 86.72 mL | 173.43 mL |
| 0.5 mM | 3.47 mL | 17.34 mL | 34.69 mL |
| 1 mM | 1.73 mL | 8.67 mL | 17.34 mL |
| 5 mM | 0.35 mL | 1.73 mL | 3.47 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
