Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BAY-2402234 is a selective dihydroorotate dehydrogenase (DHODH) inhibitor for the treatment of myeloid malignancies. |
|---|
| Catalog Num | A19822 |
|---|---|
| Formula | C21H18ClF5N4O4 |
| Molecular Weight | 520.84 |
| CAS Number | 2225819-06-5 |
| SMILES | FC1=C(NC(C2=CC(F)=C(N3N=C(CO)N(CC)C3=O)C=C2O[C@@H](C)C(F)(F)F)=O)C(Cl)=CC=C1 |
| Synonyms | BAY2402234, BAY 2402234 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 98 mg/mL (188.15 mM) | |
| Water | Insoluble | ||
| Ethanol | 32 mg/mL (61.43 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.2 mL | 96 mL | 192 mL |
| 0.5 mM | 3.84 mL | 19.2 mL | 38.4 mL |
| 1 mM | 1.92 mL | 9.6 mL | 19.2 mL |
| 5 mM | 0.38 mL | 1.92 mL | 3.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
