BAY 73-6691
Catalog No.: A17024
PDE9 inhibitor
BAY 73-6691 is a potent, selective brain penetrant PDE9A inhibitor.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | BAY 73-6691 is a potent, selective brain penetrant PDE9A inhibitor. |
|---|
| Catalog Num | A17024 |
|---|---|
| Formula | C15H12ClF3N4O |
| Molecular Weight | 356.73 |
| CAS Number | 794568-92-6 |
| SMILES | O=C1C2=C(N(C3=CC=CC=C3Cl)N=C2)NC(C[C@@H](C)C(F)(F)F)=N1 |
| Synonyms | BAY736691, BAY73-6691, UNII-80ZTV3INTW, (R)-Bay-73-6691 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2