Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BAY-876 is a potent and Selective GLUT1 Inhibitor. BAY-876 showed good metabolic stability in vitro and high oral bioavailability in vivo. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17216 |
|---|---|
| Formula | C24H16F4N6O2 |
| Molecular Weight | 496.4256 |
| CAS Number | 1799753-84-6 |
| SMILES | O=C(C1=NC2=CC(F)=CC=C2C(C(NC3=C(C)N(CC4=CC=C(C=C4)C#N)N=C3C(F)(F)F)=O)=C1)N |
| Synonyms | BAY 876, BAY876 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 88 mg/mL (177.26 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 3 mg/mL (6.04 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.14 mL | 100.72 mL | 201.44 mL |
| 0.5 mM | 4.03 mL | 20.14 mL | 40.29 mL |
| 1 mM | 2.01 mL | 10.07 mL | 20.14 mL |
| 5 mM | 0.4 mL | 2.01 mL | 4.03 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
