Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Bazedoxifene is a third generation selective estrogen receptor modulator (SERM). Bazedoxifene acetate significantly prevents bone mass loss at 20 mg/day in healthy postmenopausal women with normal or low bone mineral density. |
|---|
| Catalog Num | A11665 |
|---|---|
| Formula | C30H34N2O3.C2H4O2 |
| Molecular Weight | 530.65 |
| CAS Number | 198481-33-3 |
| SMILES | CC1=C(N(C2=C1C=C(C=C2)O)CC3=CC=C(C=C3)OCCN4CCCCCC4)C5=CC=C(C=C5)O.CC(=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 94 mg/mL (177.13 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 24 mg/mL (45.23 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.84 mL | 94.22 mL | 188.45 mL |
| 0.5 mM | 3.77 mL | 18.84 mL | 37.69 mL |
| 1 mM | 1.88 mL | 9.42 mL | 18.84 mL |
| 5 mM | 0.38 mL | 1.88 mL | 3.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
