Loading distributor info...
| Description | BD-1047 2HBr is a selective functional antagonist of sigma receptors, shows antipsychotic activity in animal models predictive of efficacy in schizophrenia. |
|---|
| Catalog Num | A13196 |
|---|---|
| Formula | C13H20Cl2N2.2HBr |
| Molecular Weight | 437.04 |
| CAS Number | 138356-21-5 |
| SMILES | ClC1=CC(CCN(C)CCN(C)C)=CC=C1Cl.Br.Br |
| Synonyms | BD 1047 dihydrobromide |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 44 mg/mL (100.67 mM) | |
| Water | 76 mg/mL (173.89 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.88 mL | 114.41 mL | 228.81 mL |
| 0.5 mM | 4.58 mL | 22.88 mL | 45.76 mL |
| 1 mM | 2.29 mL | 11.44 mL | 22.88 mL |
| 5 mM | 0.46 mL | 2.29 mL | 4.58 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
