Loading distributor info...
| Description | Benzbromarone is a CYP2C9 inhibitor, it binds to CYP2C9 with Ki value of 19.3 nM. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A16201 |
|---|---|
| Formula | C17H12Br2O3 |
| Molecular Weight | 424.08 |
| CAS Number | 3562-84-3 |
| SMILES | O=C(C1=CC(Br)=C(O)C(Br)=C1)C2=C(CC)OC3=CC=CC=C23 |
| Synonyms | L2214, L 2214, L-2214 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 82 mg/mL (193.36 mM) | |
| Water | Insoluble | ||
| Ethanol | 9 mg/mL (21.22 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.58 mL | 117.9 mL | 235.8 mL |
| 0.5 mM | 4.72 mL | 23.58 mL | 47.16 mL |
| 1 mM | 2.36 mL | 11.79 mL | 23.58 mL |
| 5 mM | 0.47 mL | 2.36 mL | 4.72 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
