Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Benzocaine hydrochloride is a surface anesthetic that acts by preventing transmission of impulses along nerve fibers and at nerve endings. |
|---|
| Catalog Num | A16130 |
|---|---|
| Formula | C9H12ClNO2 |
| Molecular Weight | 201.65 |
| CAS Number | 23239-88-5 |
| SMILES | CCOC(=O)C1=CC=C(C=C1)N.Cl |
| Synonyms | Ethoform |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 38 mg/mL (188.44 mM) | |
| Water | Insoluble | ||
| Ethanol | 38 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 49.59 mL | 247.95 mL | 495.91 mL |
| 0.5 mM | 9.92 mL | 49.59 mL | 99.18 mL |
| 1 mM | 4.96 mL | 24.8 mL | 49.59 mL |
| 5 mM | 0.99 mL | 4.96 mL | 9.92 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
