Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Beta Carotene is a strongly-coloured red-orange pigment abundant in plants and fruits. It is a precursor (inactive form) of vitamin A. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10128 |
|---|---|
| Formula | C40H56 |
| Molecular Weight | 536.87 |
| CAS Number | 7235-40-7 |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C2=C(CCCC2(C)C)C)\C)\C)/C)/C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 4 mg/mL (7.45 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 5 mg/mL (9.31 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.63 mL | 93.13 mL | 186.26 mL |
| 0.5 mM | 3.73 mL | 18.63 mL | 37.25 mL |
| 1 mM | 1.86 mL | 9.31 mL | 18.63 mL |
| 5 mM | 0.37 mL | 1.86 mL | 3.73 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
