Loading distributor info...
| Description | Beta-Lapachone is a selective DNA topoisomerase I inhibitor, exhibiting no inhibitory activities against DNA topoisomerase II or ligase. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A13059 |
|---|---|
| Formula | C15H14O3 |
| Molecular Weight | 242.27 |
| CAS Number | 4707-32-8 |
| SMILES | CC1(CCC2=C(O1)C3=CC=CC=C3C(=O)C2=O)C |
| Synonyms | ARQ-501 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 29 mg/mL (119.7 mM) | |
| Water | Insoluble | ||
| Ethanol | 9 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.28 mL | 206.38 mL | 412.76 mL |
| 0.5 mM | 8.26 mL | 41.28 mL | 82.55 mL |
| 1 mM | 4.13 mL | 20.64 mL | 41.28 mL |
| 5 mM | 0.83 mL | 4.13 mL | 8.26 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
