Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Betamethasone dipropionate is a glucocorticoid steroid with anti-inflammatory and immunosuppressive abilities. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10130 |
|---|---|
| Formula | C28H37FO7 |
| Molecular Weight | 504.6 |
| CAS Number | 5593-20-4 |
| SMILES | CCC(=O)OCC(=O)[C@]1([C@H](C[C@@H]2[C@@]1(C[C@@H]([C@]3([C@H]2CCC4=CC(=O)C=C[C@@]43C)F)O)C)C)OC(=O)CC |
| Synonyms | Diprospan, Diprolene, Diprosone, Diprolene AF |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (178.36 mM) | |
| Water | Insoluble | ||
| Ethanol | 59 mg/mL (116.92 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.82 mL | 99.09 mL | 198.18 mL |
| 0.5 mM | 3.96 mL | 19.82 mL | 39.64 mL |
| 1 mM | 1.98 mL | 9.91 mL | 19.82 mL |
| 5 mM | 0.4 mL | 1.98 mL | 3.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
