Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Betaxolol Hydrochloride is a selective beta1 adrenergic receptor blocker used in the treatment of hypertension and glaucoma. |
|---|
| Catalog Num | A11733 |
|---|---|
| Formula | C18H29NO3.HCl |
| Molecular Weight | 343.89 |
| CAS Number | 63659-19-8 |
| SMILES | OC(COc1ccc(cc1)CCOCC1CC1)CNC(C)C.Cl |
| Synonyms | Betoptic |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 61 mg/mL (177.38 mM) | |
| Water | 61 mg/mL (177.38 mM) | ||
| Ethanol | 61 mg/mL (177.38 mM) | ||
| In vivo | Saline | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.08 mL | 145.4 mL | 290.79 mL |
| 0.5 mM | 5.82 mL | 29.08 mL | 58.16 mL |
| 1 mM | 2.91 mL | 14.54 mL | 29.08 mL |
| 5 mM | 0.58 mL | 2.91 mL | 5.82 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
