Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BI-3812 is potent and efficacious BCL6 inhibitor, inhibiting the BTB domain of BCL6, with an IC50 of ??3 nM; BI-3812 has antitumor activity. |
|---|
| Catalog Num | A20311 |
|---|---|
| Formula | C26H32ClN7O5 |
| Molecular Weight | 558.03 |
| CAS Number | 2166387-64-8 |
| SMILES | ClC1=CN=C(N2CCC(C(N(C)C)=O)CC2)N=C1NC3=CC(C=C(OCC(NC)=O)C(N4C)=O)=C4C(OC)=C3 |
| Synonyms | BI3812, BI 3812 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 12 mg/mL (21.5 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.92 mL | 89.6 mL | 179.2 mL |
| 0.5 mM | 3.58 mL | 17.92 mL | 35.84 mL |
| 1 mM | 1.79 mL | 8.96 mL | 17.92 mL |
| 5 mM | 0.36 mL | 1.79 mL | 3.58 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
