Loading distributor info...
| Description | BIA10-2474 is a long-acting reversible inhibitor of fatty acid amide hydrolase (FAAH) . |
|---|
| Catalog Num | A17167 |
|---|---|
| Formula | C16H20N4O2 |
| Molecular Weight | 300.4 |
| CAS Number | 1233855-46-3 |
| SMILES | CN(C(N1C=NC(C2=C[N+]([O-])=CC=C2)=C1)=O)C3CCCCC3 |
| Synonyms | BIA10-2474, BIA 102474, BIA102474 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 4 mg/mL (13.31 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (6.65 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.29 mL | 166.44 mL | 332.89 mL |
| 0.5 mM | 6.66 mL | 33.29 mL | 66.58 mL |
| 1 mM | 3.33 mL | 16.64 mL | 33.29 mL |
| 5 mM | 0.67 mL | 3.33 mL | 6.66 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
