Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Birinapant, also known as TL32711, is a synthetic small molecule and peptido mimetic of second mitochondrial-derived activator of caspases (SMAC) and inhibitor of IAP (Inhibitor of Apoptosis Protein) family proteins, with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12738 |
|---|---|
| Formula | C42H56F2N8O6 |
| Molecular Weight | 806.94 |
| CAS Number | 1260251-31-7 |
| SMILES | CC[C@@H](C(=O)N1C[C@H](C[C@H]1CC2=C(NC3=C2C=CC(=C3)F)C4=C(C5=C(N4)C=C(C=C5)F)C[C@@H]6C[C@@H](CN6C(=O)[C@H](CC)NC(=O)[C@H](C)NC)O)O)NC(=O)[C@H](C)NC |
| Synonyms | TL-32711, TL 32711 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 87 mg/mL (107.81 mM) | |
| Water | Insoluble | ||
| Ethanol | 48 mg/mL (59.48 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 12.39 mL | 61.96 mL | 123.92 mL |
| 0.5 mM | 2.48 mL | 12.39 mL | 24.78 mL |
| 1 mM | 1.24 mL | 6.2 mL | 12.39 mL |
| 5 mM | 0.25 mL | 1.24 mL | 2.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
