Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BML-277 (Chk2 Inhibitor II) is a Chk2 (checkpoint kinase 2) inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13575 |
|---|---|
| Formula | C20H14ClN3O2 |
| Molecular Weight | 363.8 |
| CAS Number | 516480-79-8 |
| SMILES | C1=CC(=CC=C1C2=NC3=C(N2)C=C(C=C3)C(=O)N)OC4=CC=C(C=C4)Cl |
| Synonyms | BML277,BML 277 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 65 mg/mL (178.67 mM) | |
| Water | Insoluble | ||
| Ethanol | 19 mg/mL (52.22 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.49 mL | 137.44 mL | 274.88 mL |
| 0.5 mM | 5.5 mL | 27.49 mL | 54.98 mL |
| 1 mM | 2.75 mL | 13.74 mL | 27.49 mL |
| 5 mM | 0.55 mL | 2.75 mL | 5.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
