Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BMS-265246 is a potent new pyra- zolopyridine inhibitor of cdk2/cyclin E and cdk1/cyclin B, as well as cdk4/cyclin D. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11154 |
|---|---|
| Formula | C18H17F2N3O2 |
| Molecular Weight | 345.3 |
| CAS Number | 582315-72-8 |
| SMILES | CCCCOC1=C2C=NNC2=NC=C1C(=O)C3=C(C=C(C=C3F)C)F |
| Synonyms | BMS265246 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 18 mg/mL (52.12 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.96 mL | 144.8 mL | 289.6 mL |
| 0.5 mM | 5.79 mL | 28.96 mL | 57.92 mL |
| 1 mM | 2.9 mL | 14.48 mL | 28.96 mL |
| 5 mM | 0.58 mL | 2.9 mL | 5.79 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
