Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BMS-536924 is an effective inhibitor of IGF-IR, causing a reversion of an IGF-IR - mediated transformed phenotype. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11054 |
|---|---|
| Formula | C25H26ClN5O3 |
| Molecular Weight | 480 |
| CAS Number | 468740-43-4 |
| SMILES | CC1=CC(=CC2=C1N/C(=C/3\C(=CC=NC3=O)NC[C@H](C4=CC(=CC=C4)Cl)O)/N2)N5CCOCC5 |
| Synonyms | BMS536924 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 92 mg/mL (191.68 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% PEG400+0.5% Tween80+5% propylene glycol | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.83 mL | 104.17 mL | 208.33 mL |
| 0.5 mM | 4.17 mL | 20.83 mL | 41.67 mL |
| 1 mM | 2.08 mL | 10.42 mL | 20.83 mL |
| 5 mM | 0.42 mL | 2.08 mL | 4.17 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
