Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BMS-687453 is a potent and selective peroxisome proliferator activated receptor (PPAR) alpha agonist, with an EC(50) of 10 nM for human PPARalpha and approximately 410-fold selectivity vs human PPARgamma in PPAR-GAL4 transactivation assays. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15836 |
|---|---|
| Formula | C22H21ClN2O6 |
| Molecular Weight | 444.86 |
| CAS Number | 1000998-59-3 |
| SMILES | O=C(O)CN(CC1=CC=CC(OCC2=C(C)OC(C3=CC=C(Cl)C=C3)=N2)=C1)C(OC)=O |
| Synonyms | BMS687453, BMS 687453 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 80 mg/mL (179.83 mM) | |
| Water | Insoluble | ||
| Ethanol | 80 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.48 mL | 112.39 mL | 224.79 mL |
| 0.5 mM | 4.5 mL | 22.48 mL | 44.96 mL |
| 1 mM | 2.25 mL | 11.24 mL | 22.48 mL |
| 5 mM | 0.45 mL | 2.25 mL | 4.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
