Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BP-1-102 is an orally available, small-molecule inhibitor of transcription factor Stat3, with an IC50 of 6.8 μM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20347 |
|---|---|
| Formula | C29H27F5N2O6S |
| Molecular Weight | 626.59 |
| CAS Number | 1334493-07-0 |
| SMILES | O=C(O)C1=CC=C(N(CC2=CC=C(C3CCCCC3)C=C2)C(CN(C)S(=O)(C4=C(F)C(F)=C(F)C(F)=C4F)=O)=O)C=C1O |
| Synonyms | BP1-102; BP 1-102; BP1102; BP-1102; BP 1102 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 87 mg/mL (138.84 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.96 mL | 79.8 mL | 159.59 mL |
| 0.5 mM | 3.19 mL | 15.96 mL | 31.92 mL |
| 1 mM | 1.6 mL | 7.98 mL | 15.96 mL |
| 5 mM | 0.32 mL | 1.6 mL | 3.19 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
