Loading distributor info...
| Description | BQU57, a derivative of RBC8, is a selective GTPase Ral inhibitor relative to the GTPases Ras and RhoA. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A14956 |
|---|---|
| Formula | C16H13F3N4O |
| Molecular Weight | 334.1 |
| CAS Number | 1637739-82-2 |
| SMILES | CC1=NN(C)C(OC(N)=C2C#N)=C1C2C3=CC=C(C(F)(F)F)C=C3 |
| Synonyms | BQU-57 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 58 mg/mL (173.6 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 18 mg/mL (53.87 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.93 mL | 149.66 mL | 299.31 mL |
| 0.5 mM | 5.99 mL | 29.93 mL | 59.86 mL |
| 1 mM | 2.99 mL | 14.97 mL | 29.93 mL |
| 5 mM | 0.6 mL | 2.99 mL | 5.99 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
