Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Enhances differentiation of induced pluripotent stem cells (iPSCs) to hepatocytes; also promotes the maturation of iPSC-derived hepatocytes. |
|---|
| Catalog Num | A14153 |
|---|---|
| Formula | C17H18N2O2 |
| Molecular Weight | 282.34 |
| CAS Number | CAS: 2719-05-3 |
| SMILES | CC(=O)NC1=CC=C(C=C1)CC2=CC=C(C=C2)NC(=O)C |
| Synonyms | BRD-K4477,BRDK4477, FH1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 55 mg/mL (194.8 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.42 mL | 177.09 mL | 354.18 mL |
| 0.5 mM | 7.08 mL | 35.42 mL | 70.84 mL |
| 1 mM | 3.54 mL | 17.71 mL | 35.42 mL |
| 5 mM | 0.71 mL | 3.54 mL | 7.08 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
