BRD4770
Catalog No.: A14401
G9a inhibitor
BRD4770 is a novel histone methyltransferase inhibitor.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | BRD4770 is a novel histone methyltransferase inhibitor. |
|---|
| Catalog Num | A14401 |
|---|---|
| Formula | C25H23N3O3 |
| Molecular Weight | 413.47 |
| CAS Number | 1374601-40-7 |
| SMILES | COC(=O)C1=CC2=C(C=C1)N(C(=N2)NC(=O)C3=CC=CC=C3)CCCC4=CC=CC=C4 |
| Synonyms | BRD-4770, BRD 4770 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 25 mg/mL (60.46 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.19 mL | 120.93 mL | 241.86 mL |
| 0.5 mM | 4.84 mL | 24.19 mL | 48.37 mL |
| 1 mM | 2.42 mL | 12.09 mL | 24.19 mL |
| 5 mM | 0.48 mL | 2.42 mL | 4.84 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2