Loading distributor info...
| Description | Brexpiprazole is a novel D2 dopamine partial agonist investigational product currently in clinical trials for the treatment of depression, schizophrenia, and attention deficit hyperactivity disorder (ADHD). | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A13527 |
|---|---|
| Formula | C25H27N3O2S |
| Molecular Weight | 433.5733 |
| CAS Number | 913611-97-9 |
| SMILES | C1CN(CCN1CCCCOC2=CC3=C(C=C2)C=CC(=O)N3)C4=C5C=CSC5=CC=C4 |
| Synonyms | OPC 34712, OPC-34712 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 21 mg/mL (48.43 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.06 mL | 115.32 mL | 230.64 mL |
| 0.5 mM | 4.61 mL | 23.06 mL | 46.13 mL |
| 1 mM | 2.31 mL | 11.53 mL | 23.06 mL |
| 5 mM | 0.46 mL | 2.31 mL | 4.61 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
