Loading distributor info...
| Description | Brimonidine Tartrate is a highly selective α-adrenergic receptor agonist with EC50 of 0.45 nM for the α2A adrenoreceptor, and used to treat open-angle glaucoma or ocular hypertension. |
|---|
| Catalog Num | A15033 |
|---|---|
| Formula | C15H16BrN5O6 |
| Molecular Weight | 442.22 |
| CAS Number | 70359-46-5 |
| SMILES | C1CN=C(N1)NC2=C(C3=NC=CN=C3C=C2)Br.C(C(C(=O)O)O)(C(=O)O)O |
| Synonyms | AGN190342 tartrate, UK14304 tartrate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 84 mg/mL (189.95 mM) | |
| Water | 72 mg/mL (162.81 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.61 mL | 113.07 mL | 226.13 mL |
| 0.5 mM | 4.52 mL | 22.61 mL | 45.23 mL |
| 1 mM | 2.26 mL | 11.31 mL | 22.61 mL |
| 5 mM | 0.45 mL | 2.26 mL | 4.52 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
