BRL-15572 is a selective h5-HT1D antagonist, displaying 60-fold selectivity over h5-HT1B, and exhibiting little or no affinity for a range of other receptor types.
Loading distributor info...
| Description | BRL-15572 is a selective h5-HT1D antagonist, displaying 60-fold selectivity over h5-HT1B, and exhibiting little or no affinity for a range of other receptor types. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11178 |
|---|---|
| Formula | C25H29Cl3N2O |
| Molecular Weight | 479.87 |
| CAS Number | 193611-72-2 |
| SMILES | C1CN(CCN1CC(C(C2=CC=CC=C2)C3=CC=CC=C3)O)C4=CC(=CC=C4)Cl.Cl.Cl |
| Synonyms | BRL15572, BRL 15572 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 89 mg/mL (185.46 mM) | |
| Water | Insoluble | ||
| Ethanol | 37 mg/mL (77.1 mM) | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 19 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.84 mL | 104.19 mL | 208.39 mL |
| 0.5 mM | 4.17 mL | 20.84 mL | 41.68 mL |
| 1 mM | 2.08 mL | 10.42 mL | 20.84 mL |
| 5 mM | 0.42 mL | 2.08 mL | 4.17 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
