Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BTZ043 (BTZ038, BTZ044) inhibits decaprenylphosphoryl-β-d-ribose 2?-epimerase, which is an enzyme which produces the cell wall of the pathogenic bacterium Mycobacterium tuberculosis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10165 |
|---|---|
| Formula | C17H16F3N3O5S |
| Molecular Weight | 431.4 |
| CAS Number | 957217-65-1 |
| SMILES | CC1COC2(O1)CCN(CC2)C3=NC(=O)C4=CC(=CC(=C4S3)[N+](=O)[O-])C(F)(F)F |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 21 mg/mL (48.67 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% CMC | 14 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.18 mL | 115.9 mL | 231.8 mL |
| 0.5 mM | 4.64 mL | 23.18 mL | 46.36 mL |
| 1 mM | 2.32 mL | 11.59 mL | 23.18 mL |
| 5 mM | 0.46 mL | 2.32 mL | 4.64 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
