Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Bumetanide is a loop diuretic of the sulfamyl category to treat heart failure. |
|---|
| Catalog Num | A10167 |
|---|---|
| Formula | C17H20N2O5S |
| Molecular Weight | 364.4 |
| CAS Number | 28395-03-1 |
| SMILES | CCCCNC1=C(C(=CC(=C1)C(=O)O)S(=O)(=O)N)OC2=CC=CC=C2 |
| Synonyms | Bumex |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (183.85 mM) | |
| Water | Insoluble | ||
| Ethanol | 33 mg/mL (90.55 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.44 mL | 137.21 mL | 274.42 mL |
| 0.5 mM | 5.49 mL | 27.44 mL | 54.88 mL |
| 1 mM | 2.74 mL | 13.72 mL | 27.44 mL |
| 5 mM | 0.55 mL | 2.74 mL | 5.49 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
