Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | C188-9 is a potent inhibitor of STAT3 that binds to STAT3 with high affinity (KD=4.7??0.4 nM). C188-9 is well tolerated in mice, shows good oral bioavailability, and is concentrated in tumors. | |||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A16804 |
|---|---|
| Formula | C27H21NO5S |
| Molecular Weight | 471.52 |
| CAS Number | 432001-19-9 |
| SMILES | O=S(C1=CC=C(OC)C=C1)(NC2=C3C=CC=CC3=C(O)C(C4=C5C=CC=CC5=CC=C4O)=C2)=O |
| Synonyms | C 188-9; C-188-9; C-1889; C1889; C 1889; C-1889; F0808-0084; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 81 mg/mL (171.78 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (10.6 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.21 mL | 106.04 mL | 212.08 mL |
| 0.5 mM | 4.24 mL | 21.21 mL | 42.42 mL |
| 1 mM | 2.12 mL | 10.6 mL | 21.21 mL |
| 5 mM | 0.42 mL | 2.12 mL | 4.24 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
