Loading distributor info...
| Description | C25-140, a first-in-class, fairly selective TRAF6-Ubc13 inhibitor, directly binds to TRAF6, and blocks the interaction of TRAF6 with Ubc13. C25-140 lowers TRAF6 activity, reduces NF-κB activation, and combats autoimmunity. |
|---|
| Catalog Num | A18705 |
|---|---|
| Formula | C26H31N7O |
| Molecular Weight | 457.57 |
| CAS Number | 1358099-18-9 |
| SMILES | O=C(N1CCC(CC2=CC=CC=C2)CC1)CCC3=C(C)N(C4=NN5C(C=C4)=NN=C5C)N=C3C |
| Synonyms | C25140; C-25140; C 25140; C25 140; C25-140; C-25-140; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (194.5 mM) | |
| Water | Insoluble | ||
| Ethanol | 89 mg/mL (194.5 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.85 mL | 109.27 mL | 218.55 mL |
| 0.5 mM | 4.37 mL | 21.85 mL | 43.71 mL |
| 1 mM | 2.19 mL | 10.93 mL | 21.85 mL |
| 5 mM | 0.44 mL | 2.19 mL | 4.37 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
