Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Captopril is an angiotensin-converting enzyme (ACE) inhibitor used for the treatment of hypertension and some types of congestive heart failure. |
|---|
| Catalog Num | A11738 |
|---|---|
| Formula | C9H15NO3S |
| Molecular Weight | 217.3 |
| CAS Number | 62571-86-2 |
| SMILES | C[C@H](CS)C(=O)N1CCC[C@H]1C(O)=O |
| Synonyms | Capoten |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 41 mg/mL (188.69 mM) | |
| Water | 2 mg/mL (9.2 mM) | ||
| Ethanol | 41 mg/mL (188.69 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 46.02 mL | 230.1 mL | 460.19 mL |
| 0.5 mM | 9.2 mL | 46.02 mL | 92.04 mL |
| 1 mM | 4.6 mL | 23.01 mL | 46.02 mL |
| 5 mM | 0.92 mL | 4.6 mL | 9.2 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
