Signaling Pathway
CYP3A inducer
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CDD3505 is used for elevating high density lipoprotein cholesterol (HDL) by inducing hepatic cytochrome P450IIIA (CYP3A) activity. |
|---|
| Catalog Num | A20364 |
|---|---|
| Formula | C22H17N3O2 |
| Molecular Weight | 355.39 |
| CAS Number | 173865-33-3 |
| SMILES | O=[N+]([O-])C1=CN(C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C=N1 |
| Synonyms | CDD 3505, CDD-3505 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 2 mg/mL (5.62 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.14 mL | 140.69 mL | 281.38 mL |
| 0.5 mM | 5.63 mL | 28.14 mL | 56.28 mL |
| 1 mM | 2.81 mL | 14.07 mL | 28.14 mL |
| 5 mM | 0.56 mL | 2.81 mL | 5.63 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
