Total item
Cart Subtotal
$0.00 Biological Activity
CEP-32496 is an orally available v-raf murine sarcoma viral oncogene homolog B1 (B-raf) serine/threonine protein kinase inhibitor with potential antineoplastic activity.
Targets
| Target | Value | |
|---|---|---|
| c-Kit | Kd | 2nM |
| LCK | Kd | 2nM |
| PDGFRβ | Kd | 2nM |
| RET | Kd | 2nM |
| Abl1 | Kd | 3nM |
| VEGFR2 | Kd | 8nM |
| CSF-1R | Kd | 9nM |
| B-Raf(V600E) | Kd | 14nM |
| EphA2 | Kd | 14nM |
| EGFR | Kd | 22nM |
| B-Raf | Kd | 36nM |
| C-Raf | Kd | 39nM |
| c-Met | Kd | 513nM |
| JAK2 | Kd | 4.7μM |
| MEK1 | Kd | 7.1μM |
| MEK2 | Kd | 8.3μM |
| JAK1 | Kd | >10μM |
| JAK3 | Kd | >10μM |
| ALK | Kd | >10μM |
| AuroraA | Kd | >10μM |
| AuroraB | Kd | >10μM |
| ERK1 | Kd | >10μM |
| ERK2 | Kd | >10μM |
| IGF-1R | Kd | >10μM |
| INSR | Kd | >10μM |
| PIK3-CA | Kd | >10μM |
| PIK3-CB | Kd | >10μM |
| PLK1 | Kd | >10μM |
| In vitro (25°C) | DMSO | 8 mg/mL (15.46 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 15% Captisol | 14 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.32 mL | 96.62 mL | 193.24 mL |
| 0.5 mM | 3.86 mL | 19.32 mL | 38.65 mL |
| 1 mM | 1.93 mL | 9.66 mL | 19.32 mL |
| 5 mM | 0.39 mL | 1.93 mL | 3.86 mL |
*The above data is based on the productmolecular weight 517.5. Batch specific molecular weights may vary from batch to batch due to solvent of hydration, which will affect the solvent volumes required to prepare stock solutions.
| Catalog Num | A13772 |
|---|---|
| Actions | Inhibitor |
| CAS No. | 1188910-76-0 |
| Formula | C24H22F3N5O5 |
| M. Wt | 517.5 |
| Purity | >98% |
| Synonyms | CEP32496, CEP 32496, AC013773, AC 013773, AC-013773 |
| SMILES | CC(C)(C1=CC(=NO1)NC(=O)NC2=CC(=CC=C2)OC3=NC=NC4=CC(=C(C=C43)OC)OC)C(F)(F)F |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
Product Tags
Product Questions
Product Questions
No Questions
Keywords:buy CEP-32496 | CEP-32496 Supplier | purchase | cost | manufacturer | order | distributor | buy 1188910-76-0| 1188910-76-0 Supplier | purchase 1188910-76-0 | 1188910-76-0 cost | 1188910-76-0 manufacturer | order 1188910-76-0 | 1188910-76-0 distributor
Adooq Quality Guarantee
We promise all products perform as described.