Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CGP 57380 is an inhibitor of MAP-kinase interacting kinase-1 (Mnk1, MKNK1) (IC50 = 2.2 uM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13883 |
|---|---|
| Formula | C11H9FN6 |
| Molecular Weight | 244.23 |
| CAS Number | 522629-08-9 |
| SMILES | C1=CC(=CC=C1NC2=C3C(=NC=NC3=NN2)N)F |
| Synonyms | CGP57380, CGP-57380 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 43 mg/mL (176.06 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO+30% PEG 300+ddH2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.95 mL | 204.73 mL | 409.45 mL |
| 0.5 mM | 8.19 mL | 40.95 mL | 81.89 mL |
| 1 mM | 4.09 mL | 20.47 mL | 40.95 mL |
| 5 mM | 0.82 mL | 4.09 mL | 8.19 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
