Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Chelidonin inhibits tubulin polymerisation (IC50=24 uM), thereby disrupting microtubule structure in cells and inducing a G2/M mitotic arrest. |
|---|
| Catalog Num | A12147 |
|---|---|
| Formula | C20H19NO5 |
| Molecular Weight | 353.37 |
| CAS Number | 476-32-4 |
| SMILES | CN1CC2=C(C=CC3=C2OCO3)[C@@H]4[C@H]1C5=CC6=C(C=C5C[C@@H]4O)OCO6 |
| Synonyms | Stylophorin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 5 mg/mL (14.14 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.3 mL | 141.49 mL | 282.99 mL |
| 0.5 mM | 5.66 mL | 28.3 mL | 56.6 mL |
| 1 mM | 2.83 mL | 14.15 mL | 28.3 mL |
| 5 mM | 0.57 mL | 2.83 mL | 5.66 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
