Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Chitosamine hydrochloride, extracted from natural chitin. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14821 |
|---|---|
| Formula | C6H13NO5.HCl |
| Molecular Weight | 215.6 |
| CAS Number | 66-84-2 |
| SMILES | C(C(C(C(C(C=O)N)O)O)O)O.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 4 mg/mL (18.55 mM) | |
| Water | 42 mg/mL (194.77 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 46.38 mL | 231.91 mL | 463.82 mL |
| 0.5 mM | 9.28 mL | 46.38 mL | 92.76 mL |
| 1 mM | 4.64 mL | 23.19 mL | 46.38 mL |
| 5 mM | 0.93 mL | 4.64 mL | 9.28 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
