Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Chlorprothixene exerts strong antagonism at the following receptors: 5-HT2; D1, D2, D3; H1;mACh; α1-adrenergic. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10207 |
|---|---|
| Formula | C18H18ClNS |
| Molecular Weight | 315.9 |
| CAS Number | 113-59-7 |
| SMILES | CN(C)CC/C=C\1/C2=CC=CC=C2SC3=C1C=C(C=C3)Cl |
| Synonyms | Cloxan, Taractan, Truxal |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 5 mg/mL (15.83 mM) | |
| Water | Insoluble | ||
| Ethanol | 25 mg/mL (79.14 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.66 mL | 158.28 mL | 316.56 mL |
| 0.5 mM | 6.33 mL | 31.66 mL | 63.31 mL |
| 1 mM | 3.17 mL | 15.83 mL | 31.66 mL |
| 5 mM | 0.63 mL | 3.17 mL | 6.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
