Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Citalopram is a selective inhibitor of ST (5-hydroxytryptamine/serotonin transporter) and therefore is a potent and selective serotonin reuptake inhibitor. |
|---|
| Catalog Num | A10222 |
|---|---|
| Formula | C20H22BrFN2O |
| Molecular Weight | 405.31 |
| CAS Number | 59729-32-7 |
| SMILES | CN(C)CCCC1(C2=C(CO1)C=C(C=C2)C#N)C3=CC=C(C=C3)F.Br |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 80 mg/mL (197.38 mM) | |
| Water | Warmed: 80 mg/mL (197.38 mM) | ||
| Ethanol | Warmed: 80 mg/mL (197.38 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.67 mL | 123.36 mL | 246.72 mL |
| 0.5 mM | 4.93 mL | 24.67 mL | 49.34 mL |
| 1 mM | 2.47 mL | 12.34 mL | 24.67 mL |
| 5 mM | 0.49 mL | 2.47 mL | 4.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
