Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Clodronate disodium is the disodium salt of a nitrogen-free bisphosphonate analog of naturally occurring pyrophosphate. |
|---|
| Catalog Num | A13791 |
|---|---|
| Formula | CH2Cl2Na2O6P2 |
| Molecular Weight | 288.86 |
| CAS Number | 22560-50-5 |
| SMILES | C(P(=O)(O)[O-])(P(=O)(O)[O-])(Cl)Cl.[Na+].[Na+] |
| Synonyms | CL2MDP, DMDP |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 66 mg/mL (228.48 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.62 mL | 173.09 mL | 346.19 mL |
| 0.5 mM | 6.92 mL | 34.62 mL | 69.24 mL |
| 1 mM | 3.46 mL | 17.31 mL | 34.62 mL |
| 5 mM | 0.69 mL | 3.46 mL | 6.92 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
