Clofibric Acid
Catalog No.: A16463
PPARα agonist
Clofibric acid is a PPARα agonist and hypolipidemic agent.
Free Delivery on orders over $500
Research use only. We do not sell to patients.
Loading distributor info...
Loading distributor info...
| Description | Clofibric acid is a PPARα agonist and hypolipidemic agent. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A16463 |
|---|---|
| Formula | C10H11ClO3 |
| Molecular Weight | 214.65 |
| CAS Number | 882-09-7 |
| SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)Cl |
| Synonyms | Chlorofibrinic acid |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 39 mg/mL (181.69 mM) | |
| Water | Insoluble | ||
| Ethanol | 39 mg/mL (181.69 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 46.59 mL | 232.94 mL | 465.87 mL |
| 0.5 mM | 9.32 mL | 46.59 mL | 93.17 mL |
| 1 mM | 4.66 mL | 23.29 mL | 46.59 mL |
| 5 mM | 0.93 mL | 4.66 mL | 9.32 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2