Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Clonidine is classified as a centrally acting alpha adrenergic agonist.Clonidine acts centrally as an imidazoline receptor agonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10232 |
|---|---|
| Formula | C9H9Cl2N3.HCl |
| Molecular Weight | 266.56 |
| CAS Number | 4205-91-8 |
| SMILES | C1CN=C(N1)NC2=C(C=CC=C2Cl)Cl.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 46 mg/mL (172.6 mM) | |
| Water | 46 mg/mL (172.6 mM) | ||
| Ethanol | 46 mg/mL (172.6 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.52 mL | 187.58 mL | 375.15 mL |
| 0.5 mM | 7.5 mL | 37.52 mL | 75.03 mL |
| 1 mM | 3.75 mL | 18.76 mL | 37.52 mL |
| 5 mM | 0.75 mL | 3.75 mL | 7.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
