Loading distributor info...
| Description | Columbianadin, one of the active coumarins, is isolated from Radix Angelicae pubescentis which has been used as a traditional Chinese medicine for the treatment of rheumatic diseases for thousands of years. |
|---|
| Catalog Num | A14763 |
|---|---|
| Formula | C19H20O5 |
| Molecular Weight | 328.36 |
| CAS Number | 5058-13-9 |
| SMILES | CC=C(C)C(=O)OC(C)(C)C1CC2=C(O1)C=CC3=C2OC(=O)C=C3 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 58 mg/mL (176.63 mM) | |
| Ethanol | <1 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.45 mL | 152.27 mL | 304.54 mL |
| 0.5 mM | 6.09 mL | 30.45 mL | 60.91 mL |
| 1 mM | 3.05 mL | 15.23 mL | 30.45 mL |
| 5 mM | 0.61 mL | 3.05 mL | 6.09 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
